![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Aerospace engineering/ | 2018-05-15 13:20 | - | |
| Biotechnology/ | 2018-05-15 13:21 | - | |
| Chemical Engineering/ | 2018-05-15 13:21 | - | |
| Chemistry and Biochemistry/ | 2018-05-15 13:22 | - | |
| Civil Engineering/ | 2018-05-15 13:23 | - | |
| Computer Science & Engineering/ | 2019-02-21 14:01 | - | |
| Electrical Engineering/ | 2018-05-15 13:24 | - | |
| Electronics and Communication Engineering/ | 2018-05-15 13:33 | - | |
| Engineering Design/ | 2018-05-15 13:24 | - | |
| General/ | 2018-05-15 13:33 | - | |
| Humanities and Social Sciences/ | 2018-05-15 13:24 | - | |
| Management/ | 2018-05-15 13:25 | - | |
| Mathematics/ | 2018-05-15 13:25 | - | |
| Mechanical Engineering/ | 2018-05-15 13:26 | - | |
| Metallurgy and Material Science/ | 2018-05-15 13:26 | - | |
| Ocean Engineering/ | 2018-05-15 13:27 | - | |
| Physics/ | 2018-05-15 13:32 | - | |
| Textile Engineering/ | 2018-05-15 13:33 | - | |