![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Physics/ | 2018-05-15 13:10 | - | |
| Ocean Engineering/ | 2018-05-15 13:09 | - | |
| Metallurgy and Material Science/ | 2018-05-15 13:09 | - | |
| Mechanical Engineering/ | 2018-06-08 14:01 | - | |
| Mathematics/ | 2018-05-15 13:06 | - | |
| Management/ | 2018-05-15 13:06 | - | |
| Index/ | 2018-02-23 11:28 | - | |
| Humanities and Social Sciences/ | 2018-05-15 13:05 | - | |
| General/ | 2018-05-15 13:19 | - | |
| Electronics and Communication Engineering/ | 2018-05-15 13:18 | - | |
| Electrical Engineering/ | 2018-05-15 13:04 | - | |
| Computer Science & Engineering/ | 2019-02-21 13:56 | - | |
| Civil Engineering/ | 2018-05-15 12:58 | - | |
| Chemistry and Biochemistry/ | 2018-05-15 12:57 | - | |
| Chemical Engineering/ | 2018-05-15 12:57 | - | |
| Biotechnology/ | 2018-05-15 12:55 | - | |
| Architecture/ | 2018-05-15 13:19 | - | |
| Agriculture/ | 2018-05-15 13:19 | - | |
| Aerospace engineering/ | 2018-05-15 12:55 | - | |